C14H12S12 — CID 88543227
[2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-(sulfanylmethyl)-1,3-dithiol-4-yl]methanethiol (PubChem CID 88543227) has the molecular formula C14H12S12 and a molecular weight of 565.05 g/mol. Its IUPAC name is [2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-(sulfanylmethyl)-1,3-dithiol-4-yl]methanethiol.
| Compound Name | [2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-(sulfanylmethyl)-1,3-dithiol-4-yl]methanethiol |
|---|---|
| PubChem CID | 88543227 |
| Molecular Formula | C14H12S12 |
| Molecular Weight | 565.05 g/mol |
| Exact Mass | 563.76 |
| IUPAC Name | [2-[5-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene]-5-(sulfanylmethyl)-1,3-dithiol-4-yl]methanethiol |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(SC(=C4SC(CS)=C(CS)S4)S3)S2)S1 |
| InChI | InChI=1S/C14H12S12/c1-17-7-8(18-2)22-11(21-7)12-25-13-14(26-12)24-10(23-13)9-19-5(3-15)6(4-16)20-9/h15-16H,3-4H2,1-2H3 |
| InChIKey | NRPSGXDTUWSMRC-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.05 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|