C73H73N9Si — CID 88543382
(3-tert-butylphenyl)-tris[4-[4-(2-methylbutan-2-yl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]phenyl]silane (PubChem CID 88543382) has the molecular formula C73H73N9Si and a molecular weight of 1104.54 g/mol. Its IUPAC name is (3-tert-butylphenyl)-tris[4-[4-(2-methylbutan-2-yl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]phenyl]silane.
| Compound Name | (3-tert-butylphenyl)-tris[4-[4-(2-methylbutan-2-yl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]phenyl]silane |
|---|---|
| PubChem CID | 88543382 |
| Molecular Formula | C73H73N9Si |
| Molecular Weight | 1104.54 g/mol |
| Exact Mass | 1103.58 |
| IUPAC Name | (3-tert-butylphenyl)-tris[4-[4-(2-methylbutan-2-yl)-6,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]phenyl]silane |
| SMILES | CCC(C)(C)c1cnc2c(c1)c1cccnc1n2-c1ccc([Si](c2ccc(-n3c4ncccc4c4cc(C(C)(C)CC)cnc43)cc2)(c2ccc(-n3c4ncccc4c4cc(C(C)(C)CC)cnc43)cc2)c2cccc(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C73H73N9Si/c1-13-71(7,8)48-41-61-58-22-17-37-74-64(58)80(67(61)77-44-48)51-25-31-54(32-26-51)83(57-21-16-20-47(40-57)70(4,5)6,55-33-27-52(28-34-55)81-65-59(23-18-38-75-65)62-42-49(45-78-68(62)81)72(9,10)14-2)56-35-29-53(30-36-56)82-66-60(24-19-39-76-66)63-43-50(46-79-69(63)82)73(11,12)15-3/h16-46H,13-15H2,1-12H3 |
| InChIKey | VYJDXPNQJANZEL-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1104.54 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|