C34H31BrN2O3 — CID 88543569
(17R,19R,20R,22R)-22-benzyl-6-bromo-19,20-dihydroxy-20-methyl-19-phenyl-5,10-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13-hexaen-11-one (PubChem CID 88543569) has the molecular formula C34H31BrN2O3 and a molecular weight of 595.54 g/mol. Its IUPAC name is (17R,19R,20R,22R)-22-benzyl-6-bromo-19,20-dihydroxy-20-methyl-19-phenyl-5,10-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13-hexaen-11-one.
| Compound Name | (17R,19R,20R,22R)-22-benzyl-6-bromo-19,20-dihydroxy-20-methyl-19-phenyl-5,10-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13-hexaen-11-one |
|---|---|
| PubChem CID | 88543569 |
| Molecular Formula | C34H31BrN2O3 |
| Molecular Weight | 595.54 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | (17R,19R,20R,22R)-22-benzyl-6-bromo-19,20-dihydroxy-20-methyl-19-phenyl-5,10-diazapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13-hexaen-11-one |
| SMILES | C[C@@]1(O)C[C@@]2(Cc3ccccc3)c3cc4c(cc3CC[C@@H]2C[C@@]1(O)c1ccccc1)c(=O)[nH]c1ccc(Br)nc14 |
| InChI | InChI=1S/C34H31BrN2O3/c1-32(39)20-33(18-21-8-4-2-5-9-21)24(19-34(32,40)23-10-6-3-7-11-23)13-12-22-16-26-25(17-27(22)33)30-28(36-31(26)38)14-15-29(35)37-30/h2-11,14-17,24,39-40H,12-13,18-20H2,1H3,(H,36,38)/t24-,32-,33-,34-/m1/s1 |
| InChIKey | MKQCKYPFNUJSCJ-PRSAOHRXSA-N |
| XLogP | 6.31 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|