About (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine
(E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine (PubChem CID 88543575) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine |
| PubChem CID | 88543575 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine |
| SMILES | C=CN/C(C)=C(\C)CCN |
| InChI | InChI=1S/C8H16N2/c1-4-10-8(3)7(2)5-6-9/h4,10H,1,5-6,9H2,2-3H3/b8-7+ |
| InChIKey | OGMSADXHFHOPJE-BQYQJAHWSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine?
The IUPAC name of (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine (CID 88543575) is (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine.
What is the SMILES notation for (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine?
The canonical SMILES for (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine is C=CN/C(C)=C(\C)CCN.
What is the InChIKey of (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine?
The InChIKey is OGMSADXHFHOPJE-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H16N2/c1-4-10-8(3)7(2)5-6-9/h4,10H,1,5-6,9H2,2-3H3/b8-7+.
What are the key properties of (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine?
(E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine has a molecular weight of 140.23 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-N-ethenyl-3-methylpent-3-ene-1,4-diamine is sourced from PubChem (CID 88543575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).