C10H16F3N — CID 88543641
(1Z)-2-ethyl-N-methyl-N-(3,3,3-trifluoropropyl)buta-1,3-dien-1-amine (PubChem CID 88543641) has the molecular formula C10H16F3N and a molecular weight of 207.24 g/mol. Its IUPAC name is (1Z)-2-ethyl-N-methyl-N-(3,3,3-trifluoropropyl)buta-1,3-dien-1-amine.
| Compound Name | (1Z)-2-ethyl-N-methyl-N-(3,3,3-trifluoropropyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88543641 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | (1Z)-2-ethyl-N-methyl-N-(3,3,3-trifluoropropyl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N(C)CCC(F)(F)F)CC |
| InChI | InChI=1S/C10H16F3N/c1-4-9(5-2)8-14(3)7-6-10(11,12)13/h4,8H,1,5-7H2,2-3H3/b9-8+ |
| InChIKey | UKIAUIISXJHWRN-CMDGGOBGSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|