C11H19NO — CID 88544382
2-[[(2Z,4Z)-4,5-dimethylhepta-2,4,6-trienyl]amino]ethanol (PubChem CID 88544382) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[[(2Z,4Z)-4,5-dimethylhepta-2,4,6-trienyl]amino]ethanol.
| Compound Name | 2-[[(2Z,4Z)-4,5-dimethylhepta-2,4,6-trienyl]amino]ethanol |
|---|---|
| PubChem CID | 88544382 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-[[(2Z,4Z)-4,5-dimethylhepta-2,4,6-trienyl]amino]ethanol |
| SMILES | C=C/C(C)=C(C)\C=C/CNCCO |
| InChI | InChI=1S/C11H19NO/c1-4-10(2)11(3)6-5-7-12-8-9-13/h4-6,12-13H,1,7-9H2,2-3H3/b6-5-,11-10- |
| InChIKey | MLAOVZAPHCUBEL-VIFBMRGNSA-N |
| XLogP | 1.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|