About (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine
(E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine (PubChem CID 88544500) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine.
Molecular Properties
| Compound Name | (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine |
| PubChem CID | 88544500 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine |
| SMILES | C/C(=N\OC[C@H]1NCCO[C@@H]1C)C(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-8(2)9(3)13-15-7-11-10(4)14-6-5-12-11/h8,10-12H,5-7H2,1-4H3/b13-9+/t10-,11-/m1/s1 |
| InChIKey | PXTAZYHNWPPXAV-IXBWVPESSA-N |
| XLogP | 1.41 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine?
The IUPAC name of (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine (CID 88544500) is (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine.
What is the SMILES notation for (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine?
The canonical SMILES for (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine is C/C(=N\OC[C@H]1NCCO[C@@H]1C)C(C)C.
What is the InChIKey of (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine?
The InChIKey is PXTAZYHNWPPXAV-IXBWVPESSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-8(2)9(3)13-15-7-11-10(4)14-6-5-12-11/h8,10-12H,5-7H2,1-4H3/b13-9+/t10-,11-/m1/s1.
What are the key properties of (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine?
(E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine has a molecular weight of 214.31 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methyl-N-[[(2R,3R)-2-methylmorpholin-3-yl]methoxy]butan-2-imine is sourced from PubChem (CID 88544500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).