C17H15Cl3FNO4 — CID 88544557
2,5,6-trichloro-1-[(4R,6S)-6-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]indole-3-carbaldehyde (PubChem CID 88544557) has the molecular formula C17H15Cl3FNO4 and a molecular weight of 422.67 g/mol. Its IUPAC name is 2,5,6-trichloro-1-[(4R,6S)-6-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]indole-3-carbaldehyde.
| Compound Name | 2,5,6-trichloro-1-[(4R,6S)-6-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 88544557 |
| Molecular Formula | C17H15Cl3FNO4 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 2,5,6-trichloro-1-[(4R,6S)-6-(fluoromethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]indole-3-carbaldehyde |
| SMILES | CC1(C)OC2C(O1)[C@@H](CF)O[C@H]2n1c(Cl)c(C=O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C17H15Cl3FNO4/c1-17(2)25-13-12(5-21)24-16(14(13)26-17)22-11-4-10(19)9(18)3-7(11)8(6-23)15(22)20/h3-4,6,12-14,16H,5H2,1-2H3/t12-,13?,14?,16-/m1/s1 |
| InChIKey | SCGAVYKABBMLPK-UWLZSVRSSA-N |
| XLogP | 4.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|