C27H50O4Si — CID 88544737
[(4Z,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-yl] hept-6-enoate (PubChem CID 88544737) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is [(4Z,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-yl] hept-6-enoate.
| Compound Name | [(4Z,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-yl] hept-6-enoate |
|---|---|
| PubChem CID | 88544737 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | [(4Z,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-yl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC(/C(C)=C\C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC)C(C)C |
| InChI | InChI=1S/C27H50O4Si/c1-13-15-16-17-18-24(28)30-25(20(3)4)21(5)19-22(6)26(23(14-2)29-10)31-32(11,12)27(7,8)9/h13-14,19-20,22-23,25-26H,1-2,15-18H2,3-12H3/b21-19-/t22?,23-,25?,26-/m0/s1 |
| InChIKey | AXOGIEKSWLJLAR-MTLXDQHCSA-N |
| XLogP | 7.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|