C46H46O8 — CID 88544765
[6-[6-[5,8-di(propanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]anthracen-2-yl]-4-propanoyloxy-1,2,3,4-tetrahydronaphthalen-1-yl] propanoate (PubChem CID 88544765) has the molecular formula C46H46O8 and a molecular weight of 726.87 g/mol. Its IUPAC name is [6-[6-[5,8-di(propanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]anthracen-2-yl]-4-propanoyloxy-1,2,3,4-tetrahydronaphthalen-1-yl] propanoate.
| Compound Name | [6-[6-[5,8-di(propanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]anthracen-2-yl]-4-propanoyloxy-1,2,3,4-tetrahydronaphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 88544765 |
| Molecular Formula | C46H46O8 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | [6-[6-[5,8-di(propanoyloxy)-5,6,7,8-tetrahydronaphthalen-2-yl]anthracen-2-yl]-4-propanoyloxy-1,2,3,4-tetrahydronaphthalen-1-yl] propanoate |
| SMILES | CCC(=O)OC1CCC(OC(=O)CC)c2cc(-c3ccc4cc5cc(-c6ccc7c(c6)C(OC(=O)CC)CCC7OC(=O)CC)ccc5cc4c3)ccc21 |
| InChI | InChI=1S/C46H46O8/c1-5-43(47)51-39-17-19-41(53-45(49)7-3)37-25-31(13-15-35(37)39)27-9-11-29-24-34-22-28(10-12-30(34)23-33(29)21-27)32-14-16-36-38(26-32)42(54-46(50)8-4)20-18-40(36)52-44(48)6-2/h9-16,21-26,39-42H,5-8,17-20H2,1-4H3 |
| InChIKey | HBQJMLDPJGQZQU-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|