C16H14Cl3NO2 — CID 88544902
3,4-di(propan-2-ylidene)-1-(2,4,6-trichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 88544902) has the molecular formula C16H14Cl3NO2 and a molecular weight of 358.65 g/mol. Its IUPAC name is 3,4-di(propan-2-ylidene)-1-(2,4,6-trichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3,4-di(propan-2-ylidene)-1-(2,4,6-trichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 88544902 |
| Molecular Formula | C16H14Cl3NO2 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3,4-di(propan-2-ylidene)-1-(2,4,6-trichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)=C1C(=O)N(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1=C(C)C |
| InChI | InChI=1S/C16H14Cl3NO2/c1-7(2)12-13(8(3)4)16(22)20(15(12)21)14-10(18)5-9(17)6-11(14)19/h5-6H,1-4H3 |
| InChIKey | RHLKUAROJZXPRK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|