C41H32F6O4S2 — CID 88544907
3-[2-[2,5-bis(4-methoxyphenyl)-2,3-dihydrothiophen-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxyphenyl)thiophene (PubChem CID 88544907) has the molecular formula C41H32F6O4S2 and a molecular weight of 766.83 g/mol. Its IUPAC name is 3-[2-[2,5-bis(4-methoxyphenyl)-2,3-dihydrothiophen-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxyphenyl)thiophene.
| Compound Name | 3-[2-[2,5-bis(4-methoxyphenyl)-2,3-dihydrothiophen-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 88544907 |
| Molecular Formula | C41H32F6O4S2 |
| Molecular Weight | 766.83 g/mol |
| Exact Mass | 766.16 |
| IUPAC Name | 3-[2-[2,5-bis(4-methoxyphenyl)-2,3-dihydrothiophen-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2,5-bis(4-methoxyphenyl)thiophene |
| SMILES | COc1ccc(C2=C(C3=C(c4cc(-c5ccc(OC)cc5)sc4-c4ccc(OC)cc4)C(F)(F)C(F)(F)C3(F)F)CC(c3ccc(OC)cc3)S2)cc1 |
| InChI | InChI=1S/C41H32F6O4S2/c1-48-27-13-5-23(6-14-27)33-21-31(37(52-33)25-9-17-29(50-3)18-10-25)35-36(40(44,45)41(46,47)39(35,42)43)32-22-34(24-7-15-28(49-2)16-8-24)53-38(32)26-11-19-30(51-4)20-12-26/h5-21,34H,22H2,1-4H3 |
| InChIKey | HTRQKYJBQQKPDP-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.83 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|