C27H27ClN6O2 — CID 88544946
3-[[4-chloro-1-(4-phenylmethoxybutyl)imidazo[4,5-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one (PubChem CID 88544946) has the molecular formula C27H27ClN6O2 and a molecular weight of 503.01 g/mol. Its IUPAC name is 3-[[4-chloro-1-(4-phenylmethoxybutyl)imidazo[4,5-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[4-chloro-1-(4-phenylmethoxybutyl)imidazo[4,5-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 88544946 |
| Molecular Formula | C27H27ClN6O2 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 3-[[4-chloro-1-(4-phenylmethoxybutyl)imidazo[4,5-c]pyridin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2nc3c(Cl)nccc3n2CCCCOCc2ccccc2)c2cnccc2n1C1CC1 |
| InChI | InChI=1S/C27H27ClN6O2/c28-26-25-22(11-13-30-26)32(14-4-5-15-36-18-19-6-2-1-3-7-19)24(31-25)17-33-23-16-29-12-10-21(23)34(27(33)35)20-8-9-20/h1-3,6-7,10-13,16,20H,4-5,8-9,14-15,17-18H2 |
| InChIKey | KQMAEKVGLGCLHV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|