C19H21ClF3N3O5S — CID 88544957
1-[(4aR,7aR)-6-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone (PubChem CID 88544957) has the molecular formula C19H21ClF3N3O5S and a molecular weight of 495.91 g/mol. Its IUPAC name is 1-[(4aR,7aR)-6-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(4aR,7aR)-6-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 88544957 |
| Molecular Formula | C19H21ClF3N3O5S |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 1-[(4aR,7aR)-6-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)c1nc2ccc(Cl)c(S(=O)(=O)N3C[C@@H]4[C@@H](C3)OCCN4C(=O)C(F)(F)F)c2o1 |
| InChI | InChI=1S/C19H21ClF3N3O5S/c1-18(2,3)16-24-11-5-4-10(20)15(14(11)31-16)32(28,29)25-8-12-13(9-25)30-7-6-26(12)17(27)19(21,22)23/h4-5,12-13H,6-9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | BSWIXCXRDOGVIY-CHWSQXEVSA-N |
| XLogP | 2.94 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |