C7H3F11O — CID 88545032
2-(1,1-difluoroethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane (PubChem CID 88545032) has the molecular formula C7H3F11O and a molecular weight of 312.08 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane.
| Compound Name | 2-(1,1-difluoroethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane |
|---|---|
| PubChem CID | 88545032 |
| Molecular Formula | C7H3F11O |
| Molecular Weight | 312.08 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-(1,1-difluoroethyl)-2,3,3,4,4,5,5,6,6-nonafluorooxane |
| SMILES | CC(F)(F)C1(F)OC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H3F11O/c1-2(8,9)6(16)4(12,13)3(10,11)5(14,15)7(17,18)19-6/h1H3 |
| InChIKey | RZCFPNZNDSJWOO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|