About dimethyl (E)-2,7-diacetamidooct-4-enedioate
dimethyl (E)-2,7-diacetamidooct-4-enedioate (PubChem CID 88545044) has the molecular formula C14H22N2O6
and a molecular weight of 314.34 g/mol. Its IUPAC name is dimethyl (E)-2,7-diacetamidooct-4-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-2,7-diacetamidooct-4-enedioate |
| PubChem CID | 88545044 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | dimethyl (E)-2,7-diacetamidooct-4-enedioate |
| SMILES | COC(=O)C(C/C=C/CC(NC(C)=O)C(=O)OC)NC(C)=O |
| InChI | InChI=1S/C14H22N2O6/c1-9(17)15-11(13(19)21-3)7-5-6-8-12(14(20)22-4)16-10(2)18/h5-6,11-12H,7-8H2,1-4H3,(H,15,17)(H,16,18)/b6-5+ |
| InChIKey | WPKUZNKKKXOWRK-AATRIKPKSA-N |
| XLogP | -0.32 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-2,7-diacetamidooct-4-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-2,7-diacetamidooct-4-enedioate?
The IUPAC name of dimethyl (E)-2,7-diacetamidooct-4-enedioate (CID 88545044) is dimethyl (E)-2,7-diacetamidooct-4-enedioate.
What is the SMILES notation for dimethyl (E)-2,7-diacetamidooct-4-enedioate?
The canonical SMILES for dimethyl (E)-2,7-diacetamidooct-4-enedioate is COC(=O)C(C/C=C/CC(NC(C)=O)C(=O)OC)NC(C)=O.
What is the InChIKey of dimethyl (E)-2,7-diacetamidooct-4-enedioate?
The InChIKey is WPKUZNKKKXOWRK-AATRIKPKSA-N. The full InChI is InChI=1S/C14H22N2O6/c1-9(17)15-11(13(19)21-3)7-5-6-8-12(14(20)22-4)16-10(2)18/h5-6,11-12H,7-8H2,1-4H3,(H,15,17)(H,16,18)/b6-5+.
What are the key properties of dimethyl (E)-2,7-diacetamidooct-4-enedioate?
dimethyl (E)-2,7-diacetamidooct-4-enedioate has a molecular weight of 314.34 g/mol, XLogP of -0.32, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-2,7-diacetamidooct-4-enedioate is sourced from PubChem (CID 88545044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).