C36H71N3O3 — CID 88545273
1-N,2-N,3-N-tris(4-ethyl-2-methylheptyl)propane-1,2,3-tricarboxamide (PubChem CID 88545273) has the molecular formula C36H71N3O3 and a molecular weight of 593.98 g/mol. Its IUPAC name is 1-N,2-N,3-N-tris(4-ethyl-2-methylheptyl)propane-1,2,3-tricarboxamide.
| Compound Name | 1-N,2-N,3-N-tris(4-ethyl-2-methylheptyl)propane-1,2,3-tricarboxamide |
|---|---|
| PubChem CID | 88545273 |
| Molecular Formula | C36H71N3O3 |
| Molecular Weight | 593.98 g/mol |
| Exact Mass | 593.55 |
| IUPAC Name | 1-N,2-N,3-N-tris(4-ethyl-2-methylheptyl)propane-1,2,3-tricarboxamide |
| SMILES | CCCC(CC)CC(C)CNC(=O)CC(CC(=O)NCC(C)CC(CC)CCC)C(=O)NCC(C)CC(CC)CCC |
| InChI | InChI=1S/C36H71N3O3/c1-10-16-30(13-4)19-27(7)24-37-34(40)22-33(36(42)39-26-29(9)21-32(15-6)18-12-3)23-35(41)38-25-28(8)20-31(14-5)17-11-2/h27-33H,10-26H2,1-9H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | BEOBUGYPYJBHNP-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.98 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |