C18H31NO3 — CID 88545392
N-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide (PubChem CID 88545392) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide.
| Compound Name | N-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide |
|---|---|
| PubChem CID | 88545392 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienyl]hept-6-enamide |
| SMILES | C=CCCCCC(=O)NC/C(C)=C\[C@@H](C)[C@H](O)C(C=C)OC |
| InChI | InChI=1S/C18H31NO3/c1-6-8-9-10-11-17(20)19-13-14(3)12-15(4)18(21)16(7-2)22-5/h6-7,12,15-16,18,21H,1-2,8-11,13H2,3-5H3,(H,19,20)/b14-12-/t15-,16?,18+/m1/s1 |
| InChIKey | WLKOXGOZCBAGLK-INUDVONYSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|