About 2-(difluoromethoxy)-3,4-dimethylpentane
2-(difluoromethoxy)-3,4-dimethylpentane (PubChem CID 88545445) has the molecular formula C8H16F2O
and a molecular weight of 166.21 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3,4-dimethylpentane.
Molecular Properties
| Compound Name | 2-(difluoromethoxy)-3,4-dimethylpentane |
| PubChem CID | 88545445 |
| Molecular Formula | C8H16F2O |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-(difluoromethoxy)-3,4-dimethylpentane |
| SMILES | CC(C)C(C)C(C)OC(F)F |
| InChI | InChI=1S/C8H16F2O/c1-5(2)6(3)7(4)11-8(9)10/h5-8H,1-4H3 |
| InChIKey | GHHQKESPZQVNNZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethoxy)-3,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethoxy)-3,4-dimethylpentane?
The IUPAC name of 2-(difluoromethoxy)-3,4-dimethylpentane (CID 88545445) is 2-(difluoromethoxy)-3,4-dimethylpentane.
What is the SMILES notation for 2-(difluoromethoxy)-3,4-dimethylpentane?
The canonical SMILES for 2-(difluoromethoxy)-3,4-dimethylpentane is CC(C)C(C)C(C)OC(F)F.
What is the InChIKey of 2-(difluoromethoxy)-3,4-dimethylpentane?
The InChIKey is GHHQKESPZQVNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2O/c1-5(2)6(3)7(4)11-8(9)10/h5-8H,1-4H3.
What are the key properties of 2-(difluoromethoxy)-3,4-dimethylpentane?
2-(difluoromethoxy)-3,4-dimethylpentane has a molecular weight of 166.21 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethoxy)-3,4-dimethylpentane is sourced from PubChem (CID 88545445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).