C18H29NO6 — CID 88545485
3-carbamoyl-5-[4-(2,2-dimethylpropyl)-2,5-dioxooxolan-3-yl]-2,5-dimethylhexanoic acid (PubChem CID 88545485) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-carbamoyl-5-[4-(2,2-dimethylpropyl)-2,5-dioxooxolan-3-yl]-2,5-dimethylhexanoic acid.
| Compound Name | 3-carbamoyl-5-[4-(2,2-dimethylpropyl)-2,5-dioxooxolan-3-yl]-2,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 88545485 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-carbamoyl-5-[4-(2,2-dimethylpropyl)-2,5-dioxooxolan-3-yl]-2,5-dimethylhexanoic acid |
| SMILES | CC(C(=O)O)C(CC(C)(C)C1C(=O)OC(=O)C1CC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C18H29NO6/c1-9(14(21)22)10(13(19)20)8-18(5,6)12-11(7-17(2,3)4)15(23)25-16(12)24/h9-12H,7-8H2,1-6H3,(H2,19,20)(H,21,22) |
| InChIKey | BSDUIEUVHVSDEM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|