C48H52F2N4O8 — CID 88545592
bis[3-[4-[3-(2-fluoroethoxy)pyridine-2-carbonyl]piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate (PubChem CID 88545592) has the molecular formula C48H52F2N4O8 and a molecular weight of 850.96 g/mol. Its IUPAC name is bis[3-[4-[3-(2-fluoroethoxy)pyridine-2-carbonyl]piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate.
| Compound Name | bis[3-[4-[3-(2-fluoroethoxy)pyridine-2-carbonyl]piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate |
|---|---|
| PubChem CID | 88545592 |
| Molecular Formula | C48H52F2N4O8 |
| Molecular Weight | 850.96 g/mol |
| Exact Mass | 850.38 |
| IUPAC Name | bis[3-[4-[3-(2-fluoroethoxy)pyridine-2-carbonyl]piperidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl] oxalate |
| SMILES | O=C(OC1Cc2ccccc2CC1N1CCC(C(=O)c2ncccc2OCCF)CC1)C(=O)OC1Cc2ccccc2CC1N1CCC(C(=O)c2ncccc2OCCF)CC1 |
| InChI | InChI=1S/C48H52F2N4O8/c49-17-25-59-39-11-5-19-51-43(39)45(55)31-13-21-53(22-14-31)37-27-33-7-1-3-9-35(33)29-41(37)61-47(57)48(58)62-42-30-36-10-4-2-8-34(36)28-38(42)54-23-15-32(16-24-54)46(56)44-40(60-26-18-50)12-6-20-52-44/h1-12,19-20,31-32,37-38,41-42H,13-18,21-30H2 |
| InChIKey | ZCASJXDCAJKBOO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.96 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|