About [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate
[[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate (PubChem CID 88545868) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate.
Molecular Properties
| Compound Name | [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate |
| PubChem CID | 88545868 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate |
| SMILES | CC(=O)ON[C@@H]1Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C14H13NO2/c1-9(16)17-15-13-8-11-6-2-4-10-5-3-7-12(13)14(10)11/h2-7,13,15H,8H2,1H3/t13-/m1/s1 |
| InChIKey | JONPCMQZAKTTQD-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate?
The IUPAC name of [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate (CID 88545868) is [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate.
What is the SMILES notation for [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate?
The canonical SMILES for [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate is CC(=O)ON[C@@H]1Cc2cccc3cccc1c23.
What is the InChIKey of [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate?
The InChIKey is JONPCMQZAKTTQD-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H13NO2/c1-9(16)17-15-13-8-11-6-2-4-10-5-3-7-12(13)14(10)11/h2-7,13,15H,8H2,1H3/t13-/m1/s1.
What are the key properties of [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate?
[[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate has a molecular weight of 227.26 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1R)-1,2-dihydroacenaphthylen-1-yl]amino] acetate is sourced from PubChem (CID 88545868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).