C7H5NS — CID 88545926
1,2,3,4,5-pentadeuterio-6-isothiocyanatobenzene (PubChem CID 88545926) has the molecular formula C7H5NS and a molecular weight of 140.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentadeuterio-6-isothiocyanatobenzene.
| Compound Name | 1,2,3,4,5-pentadeuterio-6-isothiocyanatobenzene |
|---|---|
| PubChem CID | 88545926 |
| Molecular Formula | C7H5NS |
| Molecular Weight | 140.22 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-isothiocyanatobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(N=C=S)c([2H])c1[2H] |
| InChI | InChI=1S/C7H5NS/c9-6-8-7-4-2-1-3-5-7/h1-5H/i1D,2D,3D,4D,5D |
| InChIKey | QKFJKGMPGYROCL-RALIUCGRSA-N |
| XLogP | 2.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|