About 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid
3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid (PubChem CID 88546072) has the molecular formula C12H24N4O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid.
Molecular Properties
| Compound Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid |
| PubChem CID | 88546072 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid |
| SMILES | CC1(C)CC(N)CC(C)(CN)C1.N=C=O.N=C=O |
| InChI | InChI=1S/C10H22N2.2CHNO/c1-9(2)4-8(12)5-10(3,6-9)7-11;2*2-1-3/h8H,4-7,11-12H2,1-3H3;2*2H |
| InChIKey | AEGFVSABLZSTNE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid?
The IUPAC name of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid (CID 88546072) is 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid.
What is the SMILES notation for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid?
The canonical SMILES for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid is CC1(C)CC(N)CC(C)(CN)C1.N=C=O.N=C=O.
What is the InChIKey of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid?
The InChIKey is AEGFVSABLZSTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.2CHNO/c1-9(2)4-8(12)5-10(3,6-9)7-11;2*2-1-3/h8H,4-7,11-12H2,1-3H3;2*2H.
What are the key properties of 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid?
3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid has a molecular weight of 256.35 g/mol, XLogP of 1.29, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-3,5,5-trimethylcyclohexan-1-amine;isocyanic acid is sourced from PubChem (CID 88546072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).