C12H14F3NO5S — CID 88546260
[(2S)-4-(methoxyamino)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl] methanesulfonate (PubChem CID 88546260) has the molecular formula C12H14F3NO5S and a molecular weight of 341.31 g/mol. Its IUPAC name is [(2S)-4-(methoxyamino)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl] methanesulfonate.
| Compound Name | [(2S)-4-(methoxyamino)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 88546260 |
| Molecular Formula | C12H14F3NO5S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | [(2S)-4-(methoxyamino)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl] methanesulfonate |
| SMILES | CONC(=O)C[C@H](Cc1cc(F)c(F)cc1F)OS(C)(=O)=O |
| InChI | InChI=1S/C12H14F3NO5S/c1-20-16-12(17)5-8(21-22(2,18)19)3-7-4-10(14)11(15)6-9(7)13/h4,6,8H,3,5H2,1-2H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | VHEGUBSDTUDBGR-QMMMGPOBSA-N |
| XLogP | 1.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|