C9H16N2OSi2 — CID 88546317
2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4,4-dicarbonitrile (PubChem CID 88546317) has the molecular formula C9H16N2OSi2 and a molecular weight of 224.41 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4,4-dicarbonitrile.
| Compound Name | 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 88546317 |
| Molecular Formula | C9H16N2OSi2 |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4,4-dicarbonitrile |
| SMILES | C[Si]1(C)CC(C#N)(C#N)C[Si](C)(C)O1 |
| InChI | InChI=1S/C9H16N2OSi2/c1-13(2)7-9(5-10,6-11)8-14(3,4)12-13/h7-8H2,1-4H3 |
| InChIKey | VBSSJMOTBQVAGS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|