About ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane
ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane (PubChem CID 88546409) has the molecular formula C16H40O4Si2
and a molecular weight of 352.66 g/mol. Its IUPAC name is ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane.
Molecular Properties
| Compound Name | ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane |
| PubChem CID | 88546409 |
| Molecular Formula | C16H40O4Si2 |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane |
| SMILES | CCOCC.C[Si](C)(C)CCOCOCOCC[Si](C)(C)C |
| InChI | InChI=1S/C12H30O3Si2.C4H10O/c1-16(2,3)9-7-13-11-15-12-14-8-10-17(4,5)6;1-3-5-4-2/h7-12H2,1-6H3;3-4H2,1-2H3 |
| InChIKey | NUDZUMVESSBDEZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane?
The IUPAC name of ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane (CID 88546409) is ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane.
What is the SMILES notation for ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane?
The canonical SMILES for ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane is CCOCC.C[Si](C)(C)CCOCOCOCC[Si](C)(C)C.
What is the InChIKey of ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane?
The InChIKey is NUDZUMVESSBDEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30O3Si2.C4H10O/c1-16(2,3)9-7-13-11-15-12-14-8-10-17(4,5)6;1-3-5-4-2/h7-12H2,1-6H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane?
ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane has a molecular weight of 352.66 g/mol, XLogP of 4.67, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;trimethyl-[2-(2-trimethylsilylethoxymethoxymethoxy)ethyl]silane is sourced from PubChem (CID 88546409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).