C11H20F5NO2S — CID 88547148
3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-propylpropan-1-amine (PubChem CID 88547148) has the molecular formula C11H20F5NO2S and a molecular weight of 325.34 g/mol. Its IUPAC name is 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-propylpropan-1-amine.
| Compound Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 88547148 |
| Molecular Formula | C11H20F5NO2S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-(4,4,5,5,5-pentafluoropentylsulfonyl)-N-propylpropan-1-amine |
| SMILES | CCCNCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H20F5NO2S/c1-2-6-17-7-4-9-20(18,19)8-3-5-10(12,13)11(14,15)16/h17H,2-9H2,1H3 |
| InChIKey | GNXRHYYMNROXTD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|