C9H14ClF5O2S — CID 88547170
6-(3-chloropropylsulfonyl)-1,1,1,2,2-pentafluorohexane (PubChem CID 88547170) has the molecular formula C9H14ClF5O2S and a molecular weight of 316.72 g/mol. Its IUPAC name is 6-(3-chloropropylsulfonyl)-1,1,1,2,2-pentafluorohexane.
| Compound Name | 6-(3-chloropropylsulfonyl)-1,1,1,2,2-pentafluorohexane |
|---|---|
| PubChem CID | 88547170 |
| Molecular Formula | C9H14ClF5O2S |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 6-(3-chloropropylsulfonyl)-1,1,1,2,2-pentafluorohexane |
| SMILES | O=S(=O)(CCCCl)CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14ClF5O2S/c10-5-3-7-18(16,17)6-2-1-4-8(11,12)9(13,14)15/h1-7H2 |
| InChIKey | JREDVFUUNQAPIT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|