C8H15F5N2O2S — CID 88547183
3-amino-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)propane-1-sulfonamide (PubChem CID 88547183) has the molecular formula C8H15F5N2O2S and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-amino-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 88547183 |
| Molecular Formula | C8H15F5N2O2S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-amino-N-methyl-N-(3,3,4,4,4-pentafluorobutyl)propane-1-sulfonamide |
| SMILES | CN(CCC(F)(F)C(F)(F)F)S(=O)(=O)CCCN |
| InChI | InChI=1S/C8H15F5N2O2S/c1-15(18(16,17)6-2-4-14)5-3-7(9,10)8(11,12)13/h2-6,14H2,1H3 |
| InChIKey | NYLWCMOCBMHXLA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|