About 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine
2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine (PubChem CID 88547324) has the molecular formula C16H13ClF2N4
and a molecular weight of 334.76 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine |
| PubChem CID | 88547324 |
| Molecular Formula | C16H13ClF2N4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine |
| SMILES | Cc1nn(C)c(Nc2cccnc2Cl)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C16H13ClF2N4/c1-9-14(11-6-5-10(18)8-12(11)19)16(23(2)22-9)21-13-4-3-7-20-15(13)17/h3-8,21H,1-2H3 |
| InChIKey | DNEULYYIQSNXDJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine?
The IUPAC name of 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine (CID 88547324) is 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine.
What is the SMILES notation for 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine?
The canonical SMILES for 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine is Cc1nn(C)c(Nc2cccnc2Cl)c1-c1ccc(F)cc1F.
What is the InChIKey of 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine?
The InChIKey is DNEULYYIQSNXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF2N4/c1-9-14(11-6-5-10(18)8-12(11)19)16(23(2)22-9)21-13-4-3-7-20-15(13)17/h3-8,21H,1-2H3.
What are the key properties of 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine?
2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine has a molecular weight of 334.76 g/mol, XLogP of 4.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]pyridin-3-amine is sourced from PubChem (CID 88547324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).