About 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol
3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol (PubChem CID 88547477) has the molecular formula C11H14NO2-
and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol |
| PubChem CID | 88547477 |
| Molecular Formula | C11H14NO2- |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol |
| SMILES | [O-]N1CC(CCCO)c2ccccc21 |
| InChI | InChI=1S/C11H14NO2/c13-7-3-4-9-8-12(14)11-6-2-1-5-10(9)11/h1-2,5-6,9,13H,3-4,7-8H2/q-1 |
| InChIKey | OBESPZAHTZHWHO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol?
The IUPAC name of 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol (CID 88547477) is 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol.
What is the SMILES notation for 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol?
The canonical SMILES for 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol is [O-]N1CC(CCCO)c2ccccc21.
What is the InChIKey of 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol?
The InChIKey is OBESPZAHTZHWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO2/c13-7-3-4-9-8-12(14)11-6-2-1-5-10(9)11/h1-2,5-6,9,13H,3-4,7-8H2/q-1.
What are the key properties of 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol?
3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol has a molecular weight of 192.24 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-oxido-2,3-dihydroindol-3-yl)propan-1-ol is sourced from PubChem (CID 88547477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).