C11H6F2N4OS — CID 88547492
N-(5,6-difluoro-1,3-benzothiazol-2-yl)imidazole-1-carboxamide (PubChem CID 88547492) has the molecular formula C11H6F2N4OS and a molecular weight of 280.26 g/mol. Its IUPAC name is N-(5,6-difluoro-1,3-benzothiazol-2-yl)imidazole-1-carboxamide.
| Compound Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)imidazole-1-carboxamide |
|---|---|
| PubChem CID | 88547492 |
| Molecular Formula | C11H6F2N4OS |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | N-(5,6-difluoro-1,3-benzothiazol-2-yl)imidazole-1-carboxamide |
| SMILES | O=C(Nc1nc2cc(F)c(F)cc2s1)n1ccnc1 |
| InChI | InChI=1S/C11H6F2N4OS/c12-6-3-8-9(4-7(6)13)19-10(15-8)16-11(18)17-2-1-14-5-17/h1-5H,(H,15,16,18) |
| InChIKey | NYVKCZJWSKGKDN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |