C16H22F12O2 — CID 88547599
1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-4-ethyl-2-methylhexan-1-ol (PubChem CID 88547599) has the molecular formula C16H22F12O2 and a molecular weight of 474.33 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-4-ethyl-2-methylhexan-1-ol.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-4-ethyl-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 88547599 |
| Molecular Formula | C16H22F12O2 |
| Molecular Weight | 474.33 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)-4-ethyl-2-methylhexan-1-ol |
| SMILES | CCC(CC)CC(C)C(O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H22F12O2/c1-4-9(5-2)6-8(3)10(29)30-7-12(19,20)14(23,24)16(27,28)15(25,26)13(21,22)11(17)18/h8-11,29H,4-7H2,1-3H3 |
| InChIKey | QKSLCJVFOBYCCJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|