About 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate
2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate (PubChem CID 88547772) has the molecular formula C10H17F3O3S
and a molecular weight of 274.30 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate |
| PubChem CID | 88547772 |
| Molecular Formula | C10H17F3O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate |
| SMILES | CCCCCC/C=C/S(=O)(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H17F3O3S/c1-2-3-4-5-6-7-8-17(14,15)16-9-10(11,12)13/h7-8H,2-6,9H2,1H3/b8-7+ |
| InChIKey | HWILIIAYWBJXIL-BQYQJAHWSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate?
The IUPAC name of 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate (CID 88547772) is 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate.
What is the SMILES notation for 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate?
The canonical SMILES for 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate is CCCCCC/C=C/S(=O)(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate?
The InChIKey is HWILIIAYWBJXIL-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H17F3O3S/c1-2-3-4-5-6-7-8-17(14,15)16-9-10(11,12)13/h7-8H,2-6,9H2,1H3/b8-7+.
What are the key properties of 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate?
2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate has a molecular weight of 274.30 g/mol, XLogP of 3.38, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl (E)-oct-1-ene-1-sulfonate is sourced from PubChem (CID 88547772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).