C9H10F10O3 — CID 88547799
1,3-bis(2,2,3,3,3-pentafluoropropoxy)propan-2-ol (PubChem CID 88547799) has the molecular formula C9H10F10O3 and a molecular weight of 356.16 g/mol. Its IUPAC name is 1,3-bis(2,2,3,3,3-pentafluoropropoxy)propan-2-ol.
| Compound Name | 1,3-bis(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 88547799 |
| Molecular Formula | C9H10F10O3 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1,3-bis(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)F)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F10O3/c10-6(11,8(14,15)16)3-21-1-5(20)2-22-4-7(12,13)9(17,18)19/h5,20H,1-4H2 |
| InChIKey | XBLIEVASSCGQPI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|