About (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline
(3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline (PubChem CID 88547834) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline.
Molecular Properties
| Compound Name | (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline |
| PubChem CID | 88547834 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline |
| SMILES | C/C=C\C=C1/CN=C2CCC=CC2=N1 |
| InChI | InChI=1S/C12H14N2/c1-2-3-6-10-9-13-11-7-4-5-8-12(11)14-10/h2-3,5-6,8H,4,7,9H2,1H3/b3-2-,10-6+ |
| InChIKey | RYDGTWOLDYMYRC-BWFNYKPYSA-N |
| XLogP | 2.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline?
The IUPAC name of (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline (CID 88547834) is (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline.
What is the SMILES notation for (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline?
The canonical SMILES for (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline is C/C=C\C=C1/CN=C2CCC=CC2=N1.
What is the InChIKey of (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline?
The InChIKey is RYDGTWOLDYMYRC-BWFNYKPYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-3-6-10-9-13-11-7-4-5-8-12(11)14-10/h2-3,5-6,8H,4,7,9H2,1H3/b3-2-,10-6+.
What are the key properties of (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline?
(3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline has a molecular weight of 186.26 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(Z)-but-2-enylidene]-7,8-dihydro-2H-quinoxaline is sourced from PubChem (CID 88547834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).