C55H56F6N2O6 — CID 88547860
2-[5-[1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-(8-phenyloctoxy)phenyl]propan-2-yl]-2-(8-phenyloctoxy)phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 88547860) has the molecular formula C55H56F6N2O6 and a molecular weight of 955.05 g/mol. Its IUPAC name is 2-[5-[1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-(8-phenyloctoxy)phenyl]propan-2-yl]-2-(8-phenyloctoxy)phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-(8-phenyloctoxy)phenyl]propan-2-yl]-2-(8-phenyloctoxy)phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 88547860 |
| Molecular Formula | C55H56F6N2O6 |
| Molecular Weight | 955.05 g/mol |
| Exact Mass | 954.40 |
| IUPAC Name | 2-[5-[1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-(8-phenyloctoxy)phenyl]propan-2-yl]-2-(8-phenyloctoxy)phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1cc(C(c2ccc(OCCCCCCCCc3ccccc3)c(-n3c(=O)c4cc5c(=O)n(C)c(=O)c5cc4c3=O)c2)(C(F)(F)F)C(F)(F)F)ccc1OCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C55H56F6N2O6/c1-37-33-40(27-29-47(37)68-31-19-9-5-3-7-13-21-38-23-15-11-16-24-38)53(54(56,57)58,55(59,60)61)41-28-30-48(69-32-20-10-6-4-8-14-22-39-25-17-12-18-26-39)46(34-41)63-51(66)44-35-42-43(36-45(44)52(63)67)50(65)62(2)49(42)64/h11-12,15-18,23-30,33-36H,3-10,13-14,19-22,31-32H2,1-2H3 |
| InChIKey | XDMLTCWEACIIES-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.05 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|