About 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate
2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate (PubChem CID 88548069) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate.
Molecular Properties
| Compound Name | 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate |
| PubChem CID | 88548069 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCCC1OC1CCC |
| InChI | InChI=1S/C12H20O3/c1-4-6-10-11(15-10)7-8-14-12(13)9(3)5-2/h10-11H,3-8H2,1-2H3 |
| InChIKey | ZSVZQWCTZOWXAS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate?
The IUPAC name of 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate (CID 88548069) is 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate.
What is the SMILES notation for 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate?
The canonical SMILES for 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate is C=C(CC)C(=O)OCCC1OC1CCC.
What is the InChIKey of 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate?
The InChIKey is ZSVZQWCTZOWXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-4-6-10-11(15-10)7-8-14-12(13)9(3)5-2/h10-11H,3-8H2,1-2H3.
What are the key properties of 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate?
2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate has a molecular weight of 212.29 g/mol, XLogP of 2.45, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propyloxiran-2-yl)ethyl 2-methylidenebutanoate is sourced from PubChem (CID 88548069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).