C24H39N3O9S3 — CID 88548297
2-[2,4,6-trioxo-3,5-bis[2-[2-(sulfanylmethyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(sulfanylmethyl)butanoate (PubChem CID 88548297) has the molecular formula C24H39N3O9S3 and a molecular weight of 609.79 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis[2-[2-(sulfanylmethyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(sulfanylmethyl)butanoate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis[2-[2-(sulfanylmethyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(sulfanylmethyl)butanoate |
|---|---|
| PubChem CID | 88548297 |
| Molecular Formula | C24H39N3O9S3 |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-[2-(sulfanylmethyl)butanoyloxy]ethyl]-1,3,5-triazinan-1-yl]ethyl 2-(sulfanylmethyl)butanoate |
| SMILES | CCC(CS)C(=O)OCCn1c(=O)n(CCOC(=O)C(CC)CS)c(=O)n(CCOC(=O)C(CC)CS)c1=O |
| InChI | InChI=1S/C24H39N3O9S3/c1-4-16(13-37)19(28)34-10-7-25-22(31)26(8-11-35-20(29)17(5-2)14-38)24(33)27(23(25)32)9-12-36-21(30)18(6-3)15-39/h16-18,37-39H,4-15H2,1-3H3 |
| InChIKey | QCUBDBITAKSDQD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|