C13H19F10NO — CID 88548450
2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)-N,N-dipropylpropan-1-amine (PubChem CID 88548450) has the molecular formula C13H19F10NO and a molecular weight of 395.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)-N,N-dipropylpropan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 88548450 |
| Molecular Formula | C13H19F10NO |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H19F10NO/c1-4-6-24(7-5-2)8-10(16,17)12(20,21)25-13(22,23)11(18,19)9(3,14)15/h4-8H2,1-3H3 |
| InChIKey | QAXGHUNDFDZOST-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|