C15H24F10N2O — CID 88548451
4-[3-(dipropylamino)-1,1,2,2-tetrafluoropropoxy]-2,2,3,3,4,4-hexafluoro-N,N-dimethylbutan-1-amine (PubChem CID 88548451) has the molecular formula C15H24F10N2O and a molecular weight of 438.35 g/mol. Its IUPAC name is 4-[3-(dipropylamino)-1,1,2,2-tetrafluoropropoxy]-2,2,3,3,4,4-hexafluoro-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[3-(dipropylamino)-1,1,2,2-tetrafluoropropoxy]-2,2,3,3,4,4-hexafluoro-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 88548451 |
| Molecular Formula | C15H24F10N2O |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-[3-(dipropylamino)-1,1,2,2-tetrafluoropropoxy]-2,2,3,3,4,4-hexafluoro-N,N-dimethylbutan-1-amine |
| SMILES | CCCN(CCC)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)CN(C)C |
| InChI | InChI=1S/C15H24F10N2O/c1-5-7-27(8-6-2)10-12(18,19)14(22,23)28-15(24,25)13(20,21)11(16,17)9-26(3)4/h5-10H2,1-4H3 |
| InChIKey | PZPMYWAWGKOHRI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|