About 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine
1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine (PubChem CID 88548641) has the molecular formula C8H5BrF3N
and a molecular weight of 252.03 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine.
Molecular Properties
| Compound Name | 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine |
| PubChem CID | 88548641 |
| Molecular Formula | C8H5BrF3N |
| Molecular Weight | 252.03 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine |
| SMILES | [H]/N=C(/c1cc(Br)ccc1F)C(F)F |
| InChI | InChI=1S/C8H5BrF3N/c9-4-1-2-6(10)5(3-4)7(13)8(11)12/h1-3,8,13H/b13-7- |
| InChIKey | HRCFSOUOQGOFPQ-QPEQYQDCSA-N |
| XLogP | 3.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.03 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine?
The IUPAC name of 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine (CID 88548641) is 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine.
What is the SMILES notation for 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine?
The canonical SMILES for 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine is [H]/N=C(/c1cc(Br)ccc1F)C(F)F.
What is the InChIKey of 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine?
The InChIKey is HRCFSOUOQGOFPQ-QPEQYQDCSA-N. The full InChI is InChI=1S/C8H5BrF3N/c9-4-1-2-6(10)5(3-4)7(13)8(11)12/h1-3,8,13H/b13-7-.
What are the key properties of 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine?
1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine has a molecular weight of 252.03 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-fluorophenyl)-2,2-difluoroethanimine is sourced from PubChem (CID 88548641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).