About ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate
ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate (PubChem CID 88548670) has the molecular formula C15H21ClFN3O3
and a molecular weight of 345.80 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate |
| PubChem CID | 88548670 |
| Molecular Formula | C15H21ClFN3O3 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate |
| SMILES | CCOC(=O)C(C)[C@@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C15H21ClFN3O3/c1-3-23-13(21)9(2)15(22)6-4-5-10(7-15)19-12-11(17)8-18-14(16)20-12/h8-10,22H,3-7H2,1-2H3,(H,18,19,20)/t9?,10-,15+/m0/s1 |
| InChIKey | IKUNNUXFCXYVKK-PHTLISSDSA-N |
| XLogP | 2.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate?
The IUPAC name of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate (CID 88548670) is ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate.
What is the SMILES notation for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate?
The canonical SMILES for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate is CCOC(=O)C(C)[C@@]1(O)CCC[C@H](Nc2nc(Cl)ncc2F)C1.
What is the InChIKey of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate?
The InChIKey is IKUNNUXFCXYVKK-PHTLISSDSA-N. The full InChI is InChI=1S/C15H21ClFN3O3/c1-3-23-13(21)9(2)15(22)6-4-5-10(7-15)19-12-11(17)8-18-14(16)20-12/h8-10,22H,3-7H2,1-2H3,(H,18,19,20)/t9?,10-,15+/m0/s1.
What are the key properties of ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate?
ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate has a molecular weight of 345.80 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,3S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-1-hydroxycyclohexyl]propanoate is sourced from PubChem (CID 88548670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).