C49H44F4N10O7S2 — CID 88548698
bis[(1S,3R)-3-[[5-fluoro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl] carbonate (PubChem CID 88548698) has the molecular formula C49H44F4N10O7S2 and a molecular weight of 1025.08 g/mol. Its IUPAC name is bis[(1S,3R)-3-[[5-fluoro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl] carbonate.
| Compound Name | bis[(1S,3R)-3-[[5-fluoro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl] carbonate |
|---|---|
| PubChem CID | 88548698 |
| Molecular Formula | C49H44F4N10O7S2 |
| Molecular Weight | 1025.08 g/mol |
| Exact Mass | 1024.28 |
| IUPAC Name | bis[(1S,3R)-3-[[5-fluoro-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrimidin-4-yl]amino]cyclohexyl] carbonate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ncc(F)c(N[C@@H]4CCC[C@H](OC(=O)O[C@H]5CCC[C@@H](Nc6nc(-c7cn(S(=O)(=O)c8ccc(C)cc8)c8ncc(F)cc78)ncc6F)C5)C4)n3)c3cc(F)cnc32)cc1 |
| InChI | InChI=1S/C49H44F4N10O7S2/c1-27-9-13-35(14-10-27)71(65,66)62-25-39(37-17-29(50)21-56-47(37)62)43-54-23-41(52)45(60-43)58-31-5-3-7-33(19-31)69-49(64)70-34-8-4-6-32(20-34)59-46-42(53)24-55-44(61-46)40-26-63(48-38(40)18-30(51)22-57-48)72(67,68)36-15-11-28(2)12-16-36/h9-18,21-26,31-34H,3-8,19-20H2,1-2H3,(H,54,58,60)(H,55,59,61)/t31-,32-,33+,34+/m1/s1 |
| InChIKey | OIBGCDXDSQCMJX-WZJLIZBTSA-N |
| XLogP | 9.25 |
| TPSA | 215.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.08 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |