C42H79NO2 — CID 88549267
N,N-dimethyl-2-[(11Z,14Z)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]icosa-11,14-dienoxy]ethanamine (PubChem CID 88549267) has the molecular formula C42H79NO2 and a molecular weight of 630.10 g/mol. Its IUPAC name is N,N-dimethyl-2-[(11Z,14Z)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]icosa-11,14-dienoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[(11Z,14Z)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]icosa-11,14-dienoxy]ethanamine |
|---|---|
| PubChem CID | 88549267 |
| Molecular Formula | C42H79NO2 |
| Molecular Weight | 630.10 g/mol |
| Exact Mass | 629.61 |
| IUPAC Name | N,N-dimethyl-2-[(11Z,14Z)-3-[(9Z,12Z)-octadeca-9,12-dienoxy]icosa-11,14-dienoxy]ethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(CCCCCCC/C=C\C/C=C\CCCCC)CCOCCN(C)C |
| InChI | InChI=1S/C42H79NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-45-42(37-40-44-41-38-43(3)4)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | GNODXKYAIHOUKS-KWXKLSQISA-N |
| XLogP | 12.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.10 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|