C35H38N4O2S — CID 88549543
2-[3-cyano-4-[(1E,3E)-4-[5-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]thiophen-2-yl]buta-1,3-dienyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile (PubChem CID 88549543) has the molecular formula C35H38N4O2S and a molecular weight of 578.78 g/mol. Its IUPAC name is 2-[3-cyano-4-[(1E,3E)-4-[5-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]thiophen-2-yl]buta-1,3-dienyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4-[(1E,3E)-4-[5-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]thiophen-2-yl]buta-1,3-dienyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 88549543 |
| Molecular Formula | C35H38N4O2S |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2-[3-cyano-4-[(1E,3E)-4-[5-[(E)-2-[4-(dibutylamino)-2-methoxyphenyl]ethenyl]thiophen-2-yl]buta-1,3-dienyl]-5,5-dimethylfuran-2-ylidene]propanedinitrile |
| SMILES | CCCCN(CCCC)c1ccc(/C=C/c2ccc(/C=C/C=C/C3=C(C#N)C(=C(C#N)C#N)OC3(C)C)s2)c(OC)c1 |
| InChI | InChI=1S/C35H38N4O2S/c1-6-8-20-39(21-9-7-2)28-16-14-26(33(22-28)40-5)15-17-30-19-18-29(42-30)12-10-11-13-32-31(25-38)34(27(23-36)24-37)41-35(32,3)4/h10-19,22H,6-9,20-21H2,1-5H3/b12-10+,13-11+,17-15+ |
| InChIKey | ILZXUOCBWKAKBI-ZBLHDMJZSA-N |
| XLogP | 8.83 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|