About 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium
3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium (PubChem CID 88549640) has the molecular formula C22H50NO3PS
and a molecular weight of 439.69 g/mol. Its IUPAC name is 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium.
Molecular Properties
| Compound Name | 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium |
| PubChem CID | 88549640 |
| Molecular Formula | C22H50NO3PS |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium |
| SMILES | CC(C)NCCCS(=O)(=O)[O-].CCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36P.C6H15NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6(2)7-4-3-5-11(8,9)10/h5-16H2,1-4H3;6-7H,3-5H2,1-2H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LINCRHCZUUCOQJ-UHFFFAOYSA-M |
| XLogP | 6.12 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium?
The IUPAC name of 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium (CID 88549640) is 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium.
What is the SMILES notation for 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium?
The canonical SMILES for 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium is CC(C)NCCCS(=O)(=O)[O-].CCCC[P+](CCCC)(CCCC)CCCC.
What is the InChIKey of 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium?
The InChIKey is LINCRHCZUUCOQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36P.C6H15NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6(2)7-4-3-5-11(8,9)10/h5-16H2,1-4H3;6-7H,3-5H2,1-2H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium?
3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium has a molecular weight of 439.69 g/mol, XLogP of 6.12, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propan-2-ylamino)propane-1-sulfonate;tetrabutylphosphanium is sourced from PubChem (CID 88549640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).