About [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate
[(E)-but-2-enyl] 2-trimethylsilyloxypropanoate (PubChem CID 88549939) has the molecular formula C10H20O3Si
and a molecular weight of 216.35 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate |
| PubChem CID | 88549939 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate |
| SMILES | C/C=C/COC(=O)C(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H20O3Si/c1-6-7-8-12-10(11)9(2)13-14(3,4)5/h6-7,9H,8H2,1-5H3/b7-6+ |
| InChIKey | OWGWBRMMXMTOLQ-VOTSOKGWSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate?
The IUPAC name of [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate (CID 88549939) is [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate.
What is the SMILES notation for [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate?
The canonical SMILES for [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate is C/C=C/COC(=O)C(C)O[Si](C)(C)C.
What is the InChIKey of [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate?
The InChIKey is OWGWBRMMXMTOLQ-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H20O3Si/c1-6-7-8-12-10(11)9(2)13-14(3,4)5/h6-7,9H,8H2,1-5H3/b7-6+.
What are the key properties of [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate?
[(E)-but-2-enyl] 2-trimethylsilyloxypropanoate has a molecular weight of 216.35 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] 2-trimethylsilyloxypropanoate is sourced from PubChem (CID 88549939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).