C14H24F6O6Si2 — CID 88550840
bis(2,2,2-trifluoroethyl) 2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 88550840) has the molecular formula C14H24F6O6Si2 and a molecular weight of 458.50 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 88550840 |
| Molecular Formula | C14H24F6O6Si2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | C[Si](C)(C)OC(C(=O)OCC(F)(F)F)C(O[Si](C)(C)C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H24F6O6Si2/c1-27(2,3)25-9(11(21)23-7-13(15,16)17)10(26-28(4,5)6)12(22)24-8-14(18,19)20/h9-10H,7-8H2,1-6H3 |
| InChIKey | UIEXVWJGXVNPOQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|